Methyl-O-b-D-glucopyranosyl-(1-3)-S-b-D-glucopyranosyl-(1-4)-O-4-thio-b-D-glucopyranosyl-(1-4)-b-D-glucopyranoside
Methyl-O-b-D-glucopyranosyl-(1-3)-S-b-D-glucopyranosyl-(1-4)-O-4-thio-b-D-glucopyranosyl-(1-4)-b-D-glucopyranoside, referred to as Methyl OGSD, is a renowned compound used for studying a multitude of diseases, including the enigmatic realm of cancer. Methyl OGSD exhibits remarkable attributes by selectively targeting intricate cellular pathways, impeding the proliferation of malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 187161-22-4 |
| Pricing | Inquire |
| Cas | 187161-22-4 |
| Molecular Weight | 696.67 |
| Molecular Formula | C25H44O20S |
| Canonical SMILES | COC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)SC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O)O |