3',5'-Di-O-acetyl-2'-deoxyinosine
3',5'-Di-O-acetyl-2'-deoxyinosine is an exquisite biomedical compound with pronounced antiviral attributes. By proficiently sequestering viral proliferation, this remarkable compound etches promises for studying diseases marred by insidious RNA viruses, exemplified by the likes of influenza, hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 106568-79-0 |
| Pricing | Inquire |
| Cas | 106568-79-0 |
| Molecular Weight | 336.31 |
| Molecular Formula | C14H16N4O6 |
| Canonical SMILES | CC(=O)OCC1C(CC(O1)N2C=NC3=C2N=CNC3=O)OC(=O)C |