Narasin B
Narasin B is a polyether antibiotic produced by Str. aureofaciena NRRL 5758. It has anti-gram-positive bacteria, anaerobic bacteria, mycoplasma and coccidia activity, and also has antiviral effect. Narasin B has a protective effect on chicken coccidiosis infection.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02000 |
| Pricing | Inquire |
| Cas | 58439-94-4 |
| Molecular Weight | 763.01 |
| Molecular Formula | C43H70O11 |
| Canonical SMILES | CCC(C1C(CC(C(O1)C(C)C(C(C)C(=O)C(CC)C2C(CC(C3(O2)C=CC(=O)C4(O3)CCC(O4)(C)C5CCC(C(O5)C)(CC)O)C)C)O)C)C)C(=O)O |