Senfolomycin B
It is produced by the strain of Str. ochrosporus NRRL 3146. It has the effect of anti-Gram-positive bacteria and mycobacterium, and also has the effect of anti-Staphylococcus aureus resistant to penicillin, streptomycin, neomycin, macrolide antibiotics. It also has weaker effect of anti-Gram-negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02901 |
| Pricing | Inquire |
| Cas | 11031-56-4 |
| Molecular Weight | 702.68 |
| Molecular Formula | C29H38N2O16S |
| Canonical SMILES | CC=C(C(=O)OC1C(OC(C(C1OC2CC(C(C(O2)C)(C(C)O)O)OC)O)C3(CC(=O)C(=N)C(=C3O)C(=O)O)O)COC(=O)C)N=C=S |