Hispidanin B
Hispidanin B is extracted from the rhizomes of Isodon hispida. It displays cytotoxicity against tumor cell lines SMMC7721, K562 and SGC7901, which IC50 values are 9.8, 13.7 and 10.7uM respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1614 |
| Pricing | Inquire |
| Cas | 1616080-84-2 |
| Molecular Weight | 656.89 |
| Molecular Formula | C42H56O6 |
| Canonical SMILES | CC1=CCCC2(C1CC3C(=C)CCC4C3(CCCC4(C)C)C(=O)O)C5=C(C=CC6=C5C(CC7C6(CCCC7(C)C)C)OC(=O)C)OC2=O |