1-beta-D-Arabinofuranosylthymine
1-beta-D-Arabinofuranosylthymine is a noteworthy nucleoside analog that administers antiviral action when used in the management of herpes simplex and varicella-zoster virus infections. Its mechanism of action involves zoning in on the viral DNA polymerase to halt viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 605-23-2 |
| Pricing | Inquire |
| Cas | 605-23-2 |
| Molecular Weight | 258.23 |
| Molecular Formula | C10H14N2O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |