4-Methylumbelliferyl β-D-Galactopyranoside-6-sulfate sodium salt
4-Methylumbelliferyl β-D-Galactopyranoside-6-sulfate (4-MU-Gal-6S) is a fluorogenic substrate for N-acetylgalactosamine-6-sulphatase (GALNS). 4-MU-Gal-6S is cleaved by GALNS to release the fluorescent moiety 4-MU. 4-MU fluorescence intensity increases as pH decreases. It has been used to detect Morquio disease type A, a lysosomal storage disorder in which GALNS is deficient.
| Supplier | BOC Sciences |
|---|---|
| Product # | 206443-06-3 |
| Pricing | Inquire |
| Cas | 206443-06-3 |
| Molecular Weight | 440.35 |
| Molecular Formula | C16H17NaO11S |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)COS(=O)(=O)[O-])O)O)O.[Na+] |