Verapamil Impurity F
Verapamil Impurity F is a metabolite of Verapamil. Verapamil is a medication used for the treatment of high blood pressure, chest pain from not enough blood flow to the heart, and supraventricular tachycardia.
| Supplier | BOC Sciences |
|---|---|
| Product # | 34245-14-2 |
| Pricing | Inquire |
| Cas | 34245-14-2 |
| Molecular Weight | 290.41 |
| Molecular Formula | C17H26N2O2 |
| Canonical SMILES | CC(C)C(CCCNC)(C#N)C1=CC(=C(C=C1)OC)OC |