5-Aminoallyluridine-5'-Triphosphate
5-Aminoallyluridine-5'-Triphosphate, a fundamental component in molecular biology practices, serves as a crucial reagent for RNA-labeling processes. This particular compound efficiently integrates modified nucleotides into artificially synthesized RNA strands - a crucial step preceding further evaluation. Its utility extends to being an indispensable instrument for in-depth study of RNA's structural and functional characteristics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 161441-79-8 |
| Pricing | Inquire |
| Cas | 161441-79-8 |
| Molecular Weight | 539.20 |
| Molecular Formula | C12H20N3O15P3 |
| Canonical SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)C=CCN |