6-Chloropurine-9-beta-D-(3',5'-di-O-benzoyl-2'-deoxy-2'-fluoro)arabinoriboside
6-Chloropurine-9-beta-D-(3',5'-di-O-benzoyl-2'-deoxy-2'-fluoro)arabinoriboside is an intriguing compound prevalent in the biomedical landscape, showcasing tremendous promise in research of ailments. Emanating from its unparalleled antiviral prowess against both DNA and RNA viruses, this compound emerges as an encouraging instrument in research of thwarting pervasive viral afflictions like herpes and hepatitis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135473-15-3 |
| Pricing | Inquire |
| Cas | 135473-15-3 |
| Molecular Weight | 496.88 |
| Molecular Formula | C24H18ClFN4O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=NC4=C3N=CN=C4Cl)F)OC(=O)C5=CC=CC=C5 |