Methiothepin mesylate salt
Methiothepin mesylate salt is a 5-HT1, 5-HT6, 5-HT7 serotonin receptor antagonist. It is also a receptor antagonist in the role of serotonin in the regulation of larval Aedes aegypti hemolymph composition.
| Supplier | BOC Sciences |
|---|---|
| Product # | 74611-28-2 |
| Pricing | Inquire |
| Cas | 74611-28-2 |
| Molecular Weight | 452.65 |
| Molecular Formula | C21H28N2O3S3 |
| Canonical SMILES | CN1CCN(CC1)C2CC3=CC=CC=C3SC4=C2C=C(C=C4)SC.CS(=O)(=O)O |