Phenyl (4-((4-Ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)carbamate Hydrochloride
Phenyl (4-((4-Ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)phenyl)carbamate Hydrochloride is an intermediate in the synthesis of N-[4-[(4-Ethyl-1-piperazinyl)methyl]-3-(trifluoromethyl)phenyl]-N'-[4-[[6-(methylamino)-4-pyrimidinyl]oxy]phenyl]urea (E926495), which is an inhibitor of RET, FLT3, KDR, c-Abl and c-Kit. Also, it prevent the growth of human thyroid cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058405 |
| Pricing | Inquire |
| Cas | 1069112-56-6 |
| Molecular Weight | 407.43 + 36.46 |
| Molecular Formula | C21H24F3N3O2·HCl |
| Canonical SMILES | CCN1CCN(CC1)CC2=C(C=C(C=C2)NC(=O)OC3=CC=CC=C3)C(F)(F)F |