Chrodrimanin B
Chrodrimanin B is a meroterpenoid fungal metabolite that has been found in Talaromyces species. It has insecticidal activity against third instar silkworm larvae (LD50 = 10 μg/g of diet) and selectively inhibits the silkworm GABA receptor RDL (IC50 = 1.13 nM) over human α1β2γ2 subunit-containing GABA receptors (IC50 = 1.48 μM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 132196-54-4 |
| Pricing | Inquire |
| Cas | 132196-54-4 |
| Molecular Weight | 484.54 |
| Molecular Formula | C27H32O8 |
| Canonical SMILES | CC1C(C2=C(C(=CC3=C2CC4C5(C=CC(=O)C(C5CC(C4(O3)C)O)(C)C)C)O)C(=O)O1)OC(=O)C |