(S,R,S)-AHPC-C8-NH2 dihydrochloride
(S,R,S)-AHPC-C8-NH2 dihydrochloride is a synthetic E3 ligand-linker conjugate containing a von-Hippel-Lindau (VHL) ligand based on VH032 and an alkyl linker with terminal amine for covalent binding, which is an intermediate in the synthesis of a PROTAC degradation agent targeting AKT.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2341796-80-1 |
| Pricing | Inquire |
| Cas | 2341796-80-1 |
| Molecular Weight | 658.72 |
| Molecular Formula | C₃₁H₄₉Cl₂N₅O₄S |
| Canonical SMILES | CC1=C(C2=CC=C(C=C2)CNC([C@@H]3C[C@H](CN3C([C@H](C(C)(C)C)NC(CCCCCCCCN)=O)=O)O)=O)SC=N1.Cl.Cl |