3,5-Di-O-(tert-butyldimethylsilyl)-2-deoxy-D-ribono-1,4-lactone
3,5-Di-O-(tert-butyldimethylsilyl)-2-deoxy-D-ribono-1,4-lactone, an indispensable compound within the biomedical industry, exhibits profound significance for the advancement of targeted therapeutic agents. With its distinct and intricate molecular configuration, this invaluable compound serves as a foundation for synthesizing diverse pharmaceuticals engineered to combat ailments such as cancer, viral infections, and autoimmune disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83159-91-5 |
| Pricing | Inquire |
| Cas | 83159-91-5 |
| Molecular Weight | 360.65 |
| Molecular Formula | C17H36O4Si2 |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C(CC(=O)O1)O[Si](C)(C)C(C)(C)C |