5-Methyluridine-5'-O-triphosphate, Sodium salt
5-Methyluridine-5'-O-triphosphate, Sodium salt is a vital compound utilized in biomedical research and drug development acting as a substrate for various enzymatic reactions and is commonly employed in studies related to RNA modification and research and development. This sodium salt form enhances stability and solubility, making it ideal for investigating crucial molecular mechanisms involved in specific diseases and facilitating the development of targeted therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1801968-79-5 |
| Pricing | Inquire |
| Cas | 1801968-79-5 |
| Molecular Weight | 590.13 |
| Molecular Formula | C10H17N2Na4O15P3 |
| Canonical SMILES | [Na].O=C1NC(=O)N(C=C1C)C2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C2O |