Polyporic acid
Polyporic acid is an intermediate in the biosynthesis of allantofuranone first isolated from a mycelial culture of the fungus species Hapalopilus nidulans. It inhibits the enzyme dihydroorotate dehydrogenase and has some antifungal and antibacterial activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05447 |
| Pricing | Inquire |
| Cas | 548-59-4 |
| Molecular Weight | 292.29 |
| Molecular Formula | C18H12O4 |
| Canonical SMILES | C1=CC=C(C=C1)C2=C(C(=O)C(=C(C2=O)O)C3=CC=CC=C3)O |