6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose
6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-a-D-galactopyranose, a pivotal compound within the biomedical field, holds immense significance. Its utilization as an invaluable intermediary in the amalgamation of therapeutic substances intending to combat afflictions such as cancer, diabetes, and microbial infections is widely acknowledged. With its integral involvement in the advancement of pharmaceutical agents, this compound assumes an indisputable role in the realm of biomedical exploration and the pursuit of novel drug discoveries.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4026-28-2 |
| Pricing | Inquire |
| Cas | 4026-28-2 |
| Molecular Weight | 370.18 |
| Molecular Formula | C12H19IO5 |
| Canonical SMILES | CC1(OC2C(OC3C(C2O1)OC(O3)(C)C)CI)C |