5'-O-DMT-N6-Benzoyl-2'-deoxyadenosine 3'-CE phosphoramidite
5'-O-DMT-N6-Benzoyl-2'-deoxyadenosine 3'-CE phosphoramidite, an indispensable biomolecular tool, profoundly impacts the dynamic biomedical sphere. Its paramount significance lies in its pivotal role as a reagent for nucleoside or oligonucleotide synthesis, revolutionizing the study of DNA-protein interactions, gene expression, and research in molecular biology.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-101370 |
| Pricing | Inquire |
| Cas | 98796-53-3 |
| Molecular Weight | 857.93 |
| Molecular Formula | C47H52N7O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |