Naphthol AS-BI-Phosphate
Naphthol AS-BI-phosphate is a fluorogenic substrate for acid and alkaline phosphatases. Naphthol AS-BI-phosphate is cleaved to release the fluorescent moiety naphthol AS-BI (N-ASBI), which can be used to quantify the activity of acid and alkaline phosphatases. Acid and alkaline phosphatases are commonly used for diagnosis of diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1919-91-1 |
| Pricing | Inquire |
| Cas | 1919-91-1 |
| Molecular Weight | 452.2 |
| Molecular Formula | C18H15BrNO6P |
| Canonical SMILES | COC1=CC=CC=C1NC(=O)C2=C(C=C3C=CC(=CC3=C2)Br)OP(=O)(O)O |