4-Methoxycyclohexene-1-boronic Acid Pinacol Ester
4-Methoxycyclohexene-1-boronic Acid Pinacol Ester (CAS# 1092938-92-5) is used in the synthetic preparation of pyrazine compounds as phosphodiesterase 10 inhibitors. These inhibitors are useful in the treatment of various disorders and or diseases such as obesity, non-insulin dependent diabetes, schizophrenia, bipolar disorder and obsessive-compulsive disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB002427 |
| Pricing | Inquire |
| Cas | 1092938-92-5 |
| Molecular Weight | 238.13 |
| Molecular Formula | C13H23O3B |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)OC |