1,2-O-Isopropylidene-a-D-xylofuranuronic acid
1,2-O-Isopropylidene-a-D-xylofuranuronic acid is an intermediate compound in the biomedical industry. It is utilized in the research and development of various drugs, including those targeted towards treating metabolic disorders associated with carbohydrate absorption and processing.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35522-89-5 |
| Pricing | Inquire |
| Cas | 35522-89-5 |
| Molecular Weight | 204.18 |
| Molecular Formula | C8H12O6 |
| Canonical SMILES | CC1(OC2C(C(OC2O1)C(=O)O)O)C |