14(15)-Epoxy-5Z,8Z,11Z-eicosatrienoic acid
It has antihypertensive and anti-inflammatory properties and plays a role in the maintenance of renal vascular function. It is derived from Arachidonic Acid, which is an essential fatty acid and a precursor in the biosynthesis of prostaglandins, thromboxanes, and leukotrienes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 197508-62-6 |
| Pricing | Inquire |
| Cas | 197508-62-6 |
| Molecular Weight | 320.47 |
| Molecular Formula | C20H32O3 |
| Canonical SMILES | CCCCCC1C(O1)CC=CCC=CCC=CCCCC(=O)O |