(6-bromo-2,3-difluorophenyl)-Boronic acid
6-bromo-2,3-difluorophenyl-Boronic Acid, a boronic acid derivative, is frequently employed within the realm of palladium-catalyzed cross-coupling reactions. This complex biochemical constituent, possessing unique potential within the spheres of medicinal chemistry and drug discovery, is notably affiliated with anticancer pharmacological development endeavors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870718-10-8 |
| Pricing | Inquire |
| Cas | 870718-10-8 |
| Molecular Weight | 236.81 |
| Molecular Formula | C6H4BBrF2O2 |
| Canonical SMILES | B(C1=C(C=CC(=C1F)F)Br)(O)O |