2'',3,3',3'''-tetramethyl-1,1':4'1'':4'',1'''-quaterphenyl
2'',3,3',3'''-tetramethyl-1,1':4'1'':4'',1'''-quaterphenyl is a highly specialized organic compound extensively employed within the biomedical sector. Its intricate molecular configuration renders it an excellent candidate for the design and formulation of therapeutic agents to combat an array of ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4575-13-7 |
| Pricing | Inquire |
| Cas | 4575-13-7 |
| Molecular Weight | 362.51 |
| Molecular Formula | C28H26 |
| Canonical SMILES | CC1=CC=CC(=C1)C2=CC(=C(C=C2)C3=C(C=C(C=C3)C4=CC(=CC=C4)C)C)C |