(Amino-PEG10)-Tri-(Azide-PEG10-ethoxymethyl)-methane HCl Salt
Azide-PEG-CH2CO2H, MW 1,000 is a click chemistry polyPEG polymer, Azide is reactive with alkyne group, such as DBCO or BCN molecules via click chemistry. Carboxylic acid can conjugate with amine containing molecules such as protein, peptide in the presence of coupling reagent, HATU or EDC to form amide bond.
| Supplier | BOC Sciences |
|---|---|
| Product # | R14-0035 |
| Pricing | Inquire |
| Molecular Weight | 2374.8 |
| Molecular Formula | C102H200N14O47 |
| Canonical SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)C(=O)NC(COCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])(COCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])COCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |