6'-O-Galloylsalidroside
6'-O-Galloylsalidroside, a naturally occurring compound obtained from Rhodiola rosea, exhibits diverse pharmacological properties, characterized by its anti-tumor, anti-inflammatory, and anti-oxidative attributes. Its therapeutic potential has been demonstrated in treating liver injury and Alzheimer's disease, as per research studies. The salient features of 6'-O-galloylsalidroside make it a prime candidate for targeted therapeutic interventions in these diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP4820 |
| Pricing | Inquire |
| Cas | 83013-86-9 |
| Molecular Weight | 452.415 |
| Molecular Formula | C21H24O11 |
| Canonical SMILES | C1=CC(=CC=C1CCOC2C(C(C(C(O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O |