Napsamycin B
Napsamycin B is an antibiotic produced by Str.sp. HIL Y-82, 11372. It has antibacterial activity against Pseudomonas aeruginosa and other pseudomonas, but has weak antibacterial activity against other Gram-positive and negative bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01997 |
| Pricing | Inquire |
| Cas | 144408-86-6 |
| Molecular Weight | 866.93 |
| Molecular Formula | C40H50N8O12S |
| Canonical SMILES | CC1C2=C(CC(N1)C(=O)N(C)C(C)C(C(=O)NC=C3CC(C(O3)N4C=CC(=O)NC4=O)O)NC(=O)C(CCSC)NC(=O)NC(CC5=CC(=CC=C5)O)C(=O)O)C=C(C=C2)O |