SPDP-PEG12-NHS ester
SPDP-PEG12-NHS ester is a PEG-based PROTAC linker that has an amine-reactive N-hydroxysuccinimide (NHS) ester at one end and a sulfhydryl-reactive 2-pyridyldithiol group at the opposite end. This has a single molecular weight PEG spacer arm, which confers greater water solubility to the crosslinker and linked proteins compared to crosslinkers having only hydrocarbon spacers.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-3497 |
| Pricing | Inquire |
| Cas | 2601437-72-1 |
| Molecular Weight | 912.07 |
| Molecular Formula | C39H65N3O17S2 |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCSSC2=CC=CC=N2 |