Phenylmalonic Acid Mono-5-indanyl Ester
Phenylmalonic Acid Mono-5-indanyl Ester is an intermediate in the synthesis of Indanylcarbinicillin (S635000), an compound shown to reduce blood pressure in mammals and also has been used as a β-lactam antibiotic.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB058174 |
| Pricing | Inquire |
| Cas | 27932-00-9 |
| Molecular Weight | 296.32 |
| Molecular Formula | C18H16O4 |
| Canonical SMILES | C1CC2=C(C1)C=C(C=C2)OC(=O)C(C3=CC=CC=C3)C(=O)O |