2-(4-Aminophenyl)cyclopropane-1-carboxylic acid
2-(4-Aminophenyl)cyclopropane-1-carboxylic acid (CAS# 99060-12-5) can be used as a reactant for preparation of pyrimidine derivatives that serve as Itk inhibitors. In addition, this compound can be used for synthesis of (cyclopropylphenyl)phenyloxalamides that are known to be GPR40 receptor activators.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB074369 |
| Pricing | Inquire |
| Cas | 99060-12-5 |
| Molecular Weight | 177.2 |
| Molecular Formula | C10H11NO2 |
| Canonical SMILES | C1C(C1C(=O)O)C2=CC=C(C=C2)N |