7-Cyano-7-deazaguanosine
7-Cyano-7-deazaguanosine is a promising biomedicine product that exhibits potent anticancer and antiviral activity by inhibiting RNA and DNA synthesis. Its therapeutic potential extends to the treatment of hepatitis C as well as acute and chronic myeloid leukemia. As a modified version of guanosine, 7-Cyano-7-deazaguanosine is a unique and valuable therapeutic agent in the fight against cancer and viral infections. Its remarkable biological properties make it a promising candidate for further scientific investigation and clinical trials.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61210-21-7 |
| Pricing | Inquire |
| Cas | 61210-21-7 |
| Molecular Weight | 307.26 |
| Molecular Formula | C12H13N5O5 |
| Canonical SMILES | C1=C(C2=C(N1C3C(C(C(O3)CO)O)O)N=C(NC2=O)N)C#N |