Allyl bisphenol A
Allyl bisphenol A is a widely employed chemical compound in the biomedical sector and showcases remarkable pharmacological attributes encompassing potent antibacterial and anti-inflammatory properties. Its predominant application revolves around the creation of pharmaceutical agents directed against bacterial infections and inflammatory ailments. The immense research elucidating its therapeutic capacity endows this compound with indispensable significance in the realm of biomedical exploration and pharmaceutical innovation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1745-89-7 |
| Pricing | Inquire |
| Cas | 1745-89-7 |
| Molecular Weight | 308.41406 |
| Molecular Formula | C21H24O2 |
| Canonical SMILES | CC(C)(C1=CC(=C(C=C1)O)CC=C)C2=CC(=C(C=C2)O)CC=C |