2',3'-Dideoxy-2',2'-difluorocytidine
2',3'-Dideoxy-2',2'-difluorocytidine—a potent antiviral agent—finds clinical application in the management of HIV and hepatitis B virus (HBV) infections. By impeding the reverse transcriptase enzyme, it effectively hampers viral replication. This nucleoside analogue demonstrates a remarkable affinity for viral polymerases, ensuring minimal toxicity to host cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 124708-94-7 |
| Pricing | Inquire |
| Cas | 124708-94-7 |
| Molecular Weight | 247.20 |
| Molecular Formula | C9H11F2N3O3 |
| Canonical SMILES | C1C(OC(C1(F)F)N2C=CC(=NC2=O)N)CO |