3beta,25-OH-7-oxo-5-cholestenoic acid
3beta,25-OH-7-oxo-5-cholestenoic acid is utilized in therapeutic interventions targeting pathologies associated with aberrant bile acid metabolism, including bile acid synthesis deficiencies and cholestatic hepatic disorders. Serving as a pivotal intermediate during cholesterol conversion to bile acids, it exerts regulatory control over hepatic bile acid synthesis mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1036844-01-5 |
| Pricing | Inquire |
| Cas | 1036844-01-5 |
| Molecular Weight | 434.65 |
| Molecular Formula | C27H46O4 |
| Canonical SMILES | CC(CCCC(C)(CO)O)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C |