3-BROMO-2-(3'-BROMOBENZYLOXY)PHENYLBORO&
3-BROMO-2-(3'-BROMOBENZYLOXY)PHENYLBORO& is a paradigm-shifting boronic acid derivative that renowned and pervasive across the biomedical panorama. Demonstrating exceptional enzymatic inhibition prowess, it has unveiled auspicious merits for battling an array of maladies like neoplasms and inflammatory ailments. Owing to its idiosyncratic molecular framework, this paramount entity assumes indispensability in the realms of pharmaceutical advancements and focused therapeutics exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 849062-27-7 |
| Pricing | Inquire |
| Cas | 849062-27-7 |
| Molecular Weight | 385.846 |
| Molecular Formula | C13H11BBr2O3 |
| Canonical SMILES | B(C1=C(C(=CC=C1)Br)OCC2=CC(=CC=C2)Br)(O)O |