3-Chloro-4-nitro-2-naphthalenecarboxylic Acid
3-Chloro-4-nitro-2-naphthalenecarboxylic Acid is a versatile reactant derived from β-Naphthylamine-3-carboxylic Acid (N378050), which is an unnatural aromatic amino acid, that can be used for the manufacture of more complex compounds. β-Naphthylamine-3-carboxylic Acid can be utilized for the synthesis of novel acronycine/duocarmycin hybrid natural product.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB062433 |
| Pricing | Inquire |
| Cas | 498546-34-2 |
| Molecular Weight | 251.62 |
| Molecular Formula | C11H6ClNO4 |
| Canonical SMILES | C1=CC=C2C(=C1)C=C(C(=C2[N+](=O)[O-])Cl)C(=O)O |