6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-furo[3,2-b]pyridine
6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-furo[3,2-b]pyridine is a highly intricate and multifaceted chemical entity and stands as an influential agent employed within the biomedical domain to address distinctive maladies. Its unrivaled potential becomes evinced through its substantial effectiveness against variant forms of cancer, displaying notable prowess particularly against lung cancer and breast cancer. This exceptional product assumes a pivotal position by precisely targeting malignant cells, curtailing their proliferation, thereby engendering a propitious avenue for advancing anti-cancer pharmacotherapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1188539-34-5 |
| Pricing | Inquire |
| Cas | 1188539-34-5 |
| Molecular Weight | 245.09 |
| Molecular Formula | C13H16BNO3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CO3)N=C2 |