Conivaptan hydrochloride Impurity H
Conivaptan Hydrochloride Impurity H is an impurity of Conivaptan Hydrochloride, presenting as a pivotal therapeutic intervention for a heterogeneous spectrum of afflictions encompassing heart failure, hyponatremia and liver cirrhosis. Operating diligently as a potent inhibitor, Conivaptan Hydrochloride orchestrates the regulation of arginine vasopressin, efficaciously fostering diuresand reinstating homeostasis pertaining to electrolyte equilibrium within the corporeal domain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29489-04-1 |
| Pricing | Inquire |
| Cas | 29489-04-1 |
| Molecular Weight | 394.3 |
| Molecular Formula | C17H16BrNO3S |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(C(=O)C3=CC=CC=C32)Br |