SKI V
SKI V is a non-lipid small molecule sphingosine kinase (SphK) inhibitor. In different primary and immortalized cervical cancer cells, SKI V exerted significant anti-cancer activity by inhibiting cell viability, colony formation, proliferation, cell cycle progression and cell migration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 24418-86-8 |
| Pricing | Inquire |
| Cas | 24418-86-8 |
| Molecular Weight | 254.24 |
| Molecular Formula | C15H10O4 |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)C(=CC3=CC(=C(C=C3)O)O)O2 |