Cletoquine oxalate
Cletoquine oxalate, a chloroquine derivative, is resistant to chikungunya virus (CHIKV) and is produced in the liver by CYP2D6, CYP3A4, CYP3A5 and CYP2C8 isoenzymes. It has antimalarial effects and can be used to study autoimmune diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14142-64-4 |
| Pricing | Inquire |
| Cas | 14142-64-4 |
| Molecular Weight | 397.85 |
| Molecular Formula | C18H24ClN3O5 |
| Canonical SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl.C(=O)(C(=O)O)O |