2'-b-C-Ethynyladenosine
2'-b-C-Ethynyladenosine is a potent antiviral agent used to treat viral infections such as hepatitis B and C. This product works by inhibiting viral RNA synthesis and preventing viral replication in host cells, ultimately resulting in a decrease in viral load. It has also shown potential in treating certain types of cancers and autoimmune disorders due to its ability to target rapidly dividing cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 640725-76-4 |
| Pricing | Inquire |
| Cas | 640725-76-4 |
| Molecular Weight | 291.26 |
| Molecular Formula | C12H13N5O4 |
| Canonical SMILES | C#CC1(C(C(OC1N2C=NC3=C(N=CN=C32)N)CO)O)O |