5-Phenylcytidine
5-Phenylcytidine, an indispensable pharmaceutical compound extensively employed in the realm of biomedical research, showcases its exceptional efficacy in modulating a plethora of disorders, encompassing malignancies, viral pathologies, and neurological afflictions. Remarkably, owing to its distinctive chemical configuration, this compound unveils an auspicious potential as an anti-neoplastic, antiviral, and neuroprotective agent, thereby serving as a profound instrument in forging pioneering curative strategies and unraveling intricate mechanisms underlying diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 83866-19-7 |
| Pricing | Inquire |
| Cas | 83866-19-7 |
| Molecular Weight | 319.31 |
| Molecular Formula | C15H17N3O5 |
| Canonical SMILES | C1=CC=C(C=C1)C2=CN(C(=O)N=C2N)C3C(C(C(O3)CO)O)O |