2'-Deoxycytidylyl-(3'-5')-thymidine
2'-Deoxycytidylyl-(3'-5')-thymidine, a nucleotide analogue, holds potential as an antiviral agent against both HIV-1 and HIV-2. By inhibiting reverse transcriptase, viral replication is impeded, thus curbing infection. Research suggests that it may also be efficacious in combating cancerous cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4829-64-5 |
| Pricing | Inquire |
| Cas | 4829-64-5 |
| Molecular Weight | 531.40 |
| Molecular Formula | C19H26N5O11P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OC3CC(OC3CO)N4C=CC(=NC4=O)N)O |