Bis(3-ethyl-5-methyl-4-maleimidophenyl)methane
Bis(3-ethyl-5-methyl-4-maleimidophenyl)methane is a versatile compound widely used in the biomedical industry. It serves as a key component in the development of targeted drug delivery systems, specifically designed to treat various diseases such as cancer, autoimmune disorders, and infectious diseases. With its unique chemical properties, this compound enables precise drug encapsulation and controlled release.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2841 |
| Pricing | Inquire |
| Cas | 105391-33-1 |
| Molecular Weight | 442.51 |
| Molecular Formula | C27H26N2O4 |
| Canonical SMILES | CCC1=CC(=CC(=C1N2C(=O)C=CC2=O)C)CC3=CC(=C(C(=C3)CC)N4C(=O)C=CC4=O)C |