N2-Phenylacetyl-7'-OH-N-trityl-morpholinoguanine
N2-Phenylacetyl-7'-OH-N-trityl-morpholinoguanine is an exceptionally intricate biomedical compound, used for studying diverse ailments such as leukemia and other cancerous manifestations. It operates through targeted inhibition of vital enzymes indispensable for malignant cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1044241-98-6 |
| Pricing | Inquire |
| Cas | 1044241-98-6 |
| Molecular Weight | 626.70 |
| Molecular Formula | C37H34N6O4 |
| Canonical SMILES | OC[C@@H]1CN(C[C@@H](O1)N1C=NC2=C1N=C(NC2=O)NC(=O)CC1C=CC=CC=1)C(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 |