Anacardic acid diene
Anacardic acid is a blanket term applied to a family of closely related compounds consisting of salicylic acid with a 15-carbon alkyl chain, which exist either in a fully saturated form or as a monoene, diene, or triene. Anacardic acid diene is a polyunsaturated form of anacardic acid that has been found in cashew nut shell liquid. Anacardic acid diene has schistosomicidal activity against adult S. mansoni worms when used at a concentration of 100 μM.
| Supplier | BOC Sciences |
|---|---|
| Product # | 103904-74-1 |
| Pricing | Inquire |
| Cas | 103904-74-1 |
| Molecular Weight | 344.5 |
| Molecular Formula | C22H32O3 |
| Canonical SMILES | OC1=CC=CC(CCCCCCC/C=C\C/C=C\CCC)=C1C(O)=O |