tert-Butyl ((1R,4R)-4-(2-Hydroxyethyl)cyclohexyl)carbamate
tert-Butyl ((1R,4R)-4-(2-Hydroxyethyl)cyclohexyl)carbamate is an intermediate for the synthesis of Desmethyl Cariprazine Hydrochloride (D291365), a derivative of Cariprazine (C183490) which is an orally active D2/D3 dopamine receptor antagonist (1,2,3). Cariprazine is an antipsychotic drug candidate for the potential treatment of schizophrenia, bipolar mania and depression.
Supplier | BOC Sciences |
---|---|
Product # | BB072416 |
Pricing | Inquire |
Molecular Weight | 243.34 |
Molecular Formula | C13H25NO3 |
Canonical SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)CCO |