Pomalidomide Impurity 8
Pomalidomide Impurity 8 is an impurity of pomalidomide, which is a thalidomide derivative, a potent inhibitor of TNF-α production. It is an antiinflammatory and antitumor agent used in the treatment of multiple myeloma.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2635-64-5 |
| Pricing | Inquire |
| Cas | 2635-64-5 |
| Molecular Weight | 291.26 |
| Molecular Formula | C13H13N3O5 |
| Canonical SMILES | C1=CC2=C(C(=C1)N)C(=O)N(C2=O)C(CCC(=O)N)C(=O)O |