5-O-(t-Butyldiphenylsilyl)-1,2-O-isopropylidene-a-D-xylofuranose
5-O-(t-Butyldiphenylsilyl)-1,2-O-isopropylidene-a-D-xylofuranose is an indispensable molecular entity extensively employed within the biomedical sector, exhibiting profound potency in the regulation of pivotal biological pathways. This compound can be used for the research of viral infections, metabolic anomalies and neurodegeneration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 114861-14-2 |
| Pricing | Inquire |
| Cas | 114861-14-2 |
| Molecular Weight | 428.59 |
| Molecular Formula | C24H32O5Si |
| Canonical SMILES | CC1(OC2C(C(OC2O1)CO[Si](C3=CC=CC=C3)(C4=CC=CC=C4)C(C)(C)C)O)C |